About (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol
(1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol (PubChem CID 131848736) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol |
| PubChem CID | 131848736 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol |
| SMILES | Oc1ccc([C@@H]2C=Cc3ccccc3[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H14O2/c17-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)16(15)18/h1-10,15-18H/t15-,16-/m0/s1 |
| InChIKey | ZBOWHRZQBQBODJ-HOTGVXAUSA-N |
| XLogP | 3.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol?
The IUPAC name of (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol (CID 131848736) is (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol.
What is the SMILES notation for (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol?
The canonical SMILES for (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol is Oc1ccc([C@@H]2C=Cc3ccccc3[C@@H]2O)cc1.
What is the InChIKey of (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol?
The InChIKey is ZBOWHRZQBQBODJ-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H14O2/c17-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)16(15)18/h1-10,15-18H/t15-,16-/m0/s1.
What are the key properties of (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol?
(1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol has a molecular weight of 238.29 g/mol, XLogP of 3.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-(4-hydroxyphenyl)-1,2-dihydronaphthalen-1-ol is sourced from PubChem (CID 131848736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).