C7H12O3 — CID 131848834
(3R,4S)-3,4-dimethoxy-3,4-dihydro-2H-pyran (PubChem CID 131848834) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (3R,4S)-3,4-dimethoxy-3,4-dihydro-2H-pyran.
| Compound Name | (3R,4S)-3,4-dimethoxy-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 131848834 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (3R,4S)-3,4-dimethoxy-3,4-dihydro-2H-pyran |
| SMILES | CO[C@H]1C=COC[C@H]1OC |
| InChI | InChI=1S/C7H12O3/c1-8-6-3-4-10-5-7(6)9-2/h3-4,6-7H,5H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | YVVLBMSVIDQHKH-NKWVEPMBSA-N |
| XLogP | 0.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |