About CID 131848855
CID 131848855 (PubChem CID 131848855) has the molecular formula C8H9NNaO7S
and a molecular weight of 286.22 g/mol.
Molecular Properties
| Compound Name | CID 131848855 |
| PubChem CID | 131848855 |
| Molecular Formula | C8H9NNaO7S |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na] |
| InChI | InChI=1S/C8H9NO7S.Na/c1-4(2)8(12)16-9-6(10)3-5(7(9)11)17(13,14)15;/h5H,1,3H2,2H3,(H,13,14,15); |
| InChIKey | XKUFLUJSADVZIN-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 131848855 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131848855?
The IUPAC name of CID 131848855 (CID 131848855) is not available.
What is the SMILES notation for CID 131848855?
The canonical SMILES for CID 131848855 is C=C(C)C(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O.[Na].
What is the InChIKey of CID 131848855?
The InChIKey is XKUFLUJSADVZIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO7S.Na/c1-4(2)8(12)16-9-6(10)3-5(7(9)11)17(13,14)15;/h5H,1,3H2,2H3,(H,13,14,15);.
What are the key properties of CID 131848855?
CID 131848855 has a molecular weight of 286.22 g/mol, XLogP of -1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131848855 is sourced from PubChem (CID 131848855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).