About N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine
N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine (PubChem CID 131848892) has the molecular formula C10H9Cl2NO
and a molecular weight of 230.09 g/mol. Its IUPAC name is N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
| PubChem CID | 131848892 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine |
| SMILES | ON=C1CCCc2c1ccc(Cl)c2Cl |
| InChI | InChI=1S/C10H9Cl2NO/c11-8-5-4-6-7(10(8)12)2-1-3-9(6)13-14/h4-5,14H,1-3H2 |
| InChIKey | HZNIPTLGWRVNBL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine?
The IUPAC name of N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine (CID 131848892) is N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine.
What is the SMILES notation for N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine?
The canonical SMILES for N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine is ON=C1CCCc2c1ccc(Cl)c2Cl.
What is the InChIKey of N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine?
The InChIKey is HZNIPTLGWRVNBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2NO/c11-8-5-4-6-7(10(8)12)2-1-3-9(6)13-14/h4-5,14H,1-3H2.
What are the key properties of N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine?
N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine has a molecular weight of 230.09 g/mol, XLogP of 3.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dichloro-3,4-dihydro-2H-naphthalen-1-ylidene)hydroxylamine is sourced from PubChem (CID 131848892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).