C20H24O9S2 — CID 131849233
[(2R,3R,4R,5S)-4-hydroxy-5-methoxy-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 131849233) has the molecular formula C20H24O9S2 and a molecular weight of 472.54 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4-hydroxy-5-methoxy-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5S)-4-hydroxy-5-methoxy-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 131849233 |
| Molecular Formula | C20H24O9S2 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [(2R,3R,4R,5S)-4-hydroxy-5-methoxy-3-(4-methylphenyl)sulfonyloxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@H]1O[C@H](COS(=O)(=O)c2ccc(C)cc2)[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@H]1O |
| InChI | InChI=1S/C20H24O9S2/c1-13-4-8-15(9-5-13)30(22,23)27-12-17-19(18(21)20(26-3)28-17)29-31(24,25)16-10-6-14(2)7-11-16/h4-11,17-21H,12H2,1-3H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | UDTDTEUOSXDIRV-ZRNYENFQSA-N |
| XLogP | 1.52 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|