About Acid Violet 49
Acid Violet 49 (PubChem CID 131849478) has the molecular formula C39H41N3NaO6S2
and a molecular weight of 734.90 g/mol.
Molecular Properties
| Compound Name | Acid Violet 49 |
| PubChem CID | 131849478 |
| Molecular Formula | C39H41N3NaO6S2 |
| Molecular Weight | 734.90 g/mol |
| Exact Mass | 734.23 |
| IUPAC Name | — |
| SMILES | CCN(Cc1cccc(S(=O)(=O)[O-])c1)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(CC)Cc3cccc(S(=O)(=O)O)c3)cc2)cc1.[Na] |
| InChI | InChI=1S/C39H41N3O6S2.Na/c1-5-41(27-29-9-7-11-37(25-29)49(43,44)45)35-21-15-32(16-22-35)39(31-13-19-34(20-14-31)40(3)4)33-17-23-36(24-18-33)42(6-2)28-30-10-8-12-38(26-30)50(46,47)48;/h7-26H,5-6,27-28H2,1-4H3,(H-,43,44,45,46,47,48); |
| InChIKey | WTIXYDSCBZQJIC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 734.90 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze Acid Violet 49 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Acid Violet 49?
The IUPAC name of Acid Violet 49 (CID 131849478) is not available.
What is the SMILES notation for Acid Violet 49?
The canonical SMILES for Acid Violet 49 is CCN(Cc1cccc(S(=O)(=O)[O-])c1)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(CC)Cc3cccc(S(=O)(=O)O)c3)cc2)cc1.[Na].
What is the InChIKey of Acid Violet 49?
The InChIKey is WTIXYDSCBZQJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H41N3O6S2.Na/c1-5-41(27-29-9-7-11-37(25-29)49(43,44)45)35-21-15-32(16-22-35)39(31-13-19-34(20-14-31)40(3)4)33-17-23-36(24-18-33)42(6-2)28-30-10-8-12-38(26-30)50(46,47)48;/h7-26H,5-6,27-28H2,1-4H3,(H-,43,44,45,46,47,48);.
What are the key properties of Acid Violet 49?
Acid Violet 49 has a molecular weight of 734.90 g/mol, XLogP of 6.15, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Acid Violet 49 is sourced from PubChem (CID 131849478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).