C17H18N2O3 — CID 131849552
3-(4-methoxy-3-phenylmethoxyphenyl)prop-2-enehydrazide (PubChem CID 131849552) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-(4-methoxy-3-phenylmethoxyphenyl)prop-2-enehydrazide.
| Compound Name | 3-(4-methoxy-3-phenylmethoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 131849552 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(4-methoxy-3-phenylmethoxyphenyl)prop-2-enehydrazide |
| SMILES | COc1ccc(C=CC(=O)NN)cc1OCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c1-21-15-9-7-13(8-10-17(20)19-18)11-16(15)22-12-14-5-3-2-4-6-14/h2-11H,12,18H2,1H3,(H,19,20) |
| InChIKey | HBPKXUNZPVPJFS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|