C11H13NO2 — CID 13184973
2-prop-2-enyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 13184973) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-prop-2-enyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-prop-2-enyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 13184973 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-prop-2-enyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C=CCN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C11H13NO2/c1-2-7-12-10(13)8-5-3-4-6-9(8)11(12)14/h2-4,8-9H,1,5-7H2 |
| InChIKey | SNJFYQMFIMYANQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|