C7H6O3 — CID 131849967
2,3,6-trideuterio-4,5-dihydroxybenzaldehyde (PubChem CID 131849967) has the molecular formula C7H6O3 and a molecular weight of 141.14 g/mol. Its IUPAC name is 2,3,6-trideuterio-4,5-dihydroxybenzaldehyde.
| Compound Name | 2,3,6-trideuterio-4,5-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 131849967 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 2,3,6-trideuterio-4,5-dihydroxybenzaldehyde |
| SMILES | [2H]c1c([2H])c(C=O)c([2H])c(O)c1O |
| InChI | InChI=1S/C7H6O3/c8-4-5-1-2-6(9)7(10)3-5/h1-4,9-10H/i1D,2D,3D |
| InChIKey | IBGBGRVKPALMCQ-CBYSEHNBSA-N |
| XLogP | 0.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|