About methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride
methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride (PubChem CID 131850093) has the molecular formula C5H9ClN2O2S
and a molecular weight of 196.66 g/mol. Its IUPAC name is methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride.
Molecular Properties
| Compound Name | methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride |
| PubChem CID | 131850093 |
| Molecular Formula | C5H9ClN2O2S |
| Molecular Weight | 196.66 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride |
| SMILES | COC(=O)NC1=NCCS1.Cl |
| InChI | InChI=1S/C5H8N2O2S.ClH/c1-9-5(8)7-4-6-2-3-10-4;/h2-3H2,1H3,(H,6,7,8);1H |
| InChIKey | ICXUOPMYXBOXNX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.66 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride?
The IUPAC name of methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride (CID 131850093) is methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride.
What is the SMILES notation for methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride?
The canonical SMILES for methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride is COC(=O)NC1=NCCS1.Cl.
What is the InChIKey of methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride?
The InChIKey is ICXUOPMYXBOXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2S.ClH/c1-9-5(8)7-4-6-2-3-10-4;/h2-3H2,1H3,(H,6,7,8);1H.
What are the key properties of methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride?
methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride has a molecular weight of 196.66 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(4,5-dihydro-1,3-thiazol-2-yl)carbamate;hydrochloride is sourced from PubChem (CID 131850093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).