C21H20F3NO4 — CID 131850321
dimethyl 1-benzyl-3-(2,3,6-trifluorophenyl)pyrrolidine-3,4-dicarboxylate (PubChem CID 131850321) has the molecular formula C21H20F3NO4 and a molecular weight of 407.39 g/mol. Its IUPAC name is dimethyl 1-benzyl-3-(2,3,6-trifluorophenyl)pyrrolidine-3,4-dicarboxylate.
| Compound Name | dimethyl 1-benzyl-3-(2,3,6-trifluorophenyl)pyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 131850321 |
| Molecular Formula | C21H20F3NO4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | dimethyl 1-benzyl-3-(2,3,6-trifluorophenyl)pyrrolidine-3,4-dicarboxylate |
| SMILES | COC(=O)C1CN(Cc2ccccc2)CC1(C(=O)OC)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C21H20F3NO4/c1-28-19(26)14-11-25(10-13-6-4-3-5-7-13)12-21(14,20(27)29-2)17-15(22)8-9-16(23)18(17)24/h3-9,14H,10-12H2,1-2H3 |
| InChIKey | RTFHZHTUAWRWCY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|