C10H12Cl3NO — CID 131850472
(2S)-3-(benzylamino)-1,1,1-trichloropropan-2-ol (PubChem CID 131850472) has the molecular formula C10H12Cl3NO and a molecular weight of 268.57 g/mol. Its IUPAC name is (2S)-3-(benzylamino)-1,1,1-trichloropropan-2-ol.
| Compound Name | (2S)-3-(benzylamino)-1,1,1-trichloropropan-2-ol |
|---|---|
| PubChem CID | 131850472 |
| Molecular Formula | C10H12Cl3NO |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | (2S)-3-(benzylamino)-1,1,1-trichloropropan-2-ol |
| SMILES | O[C@@H](CNCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3NO/c11-10(12,13)9(15)7-14-6-8-4-2-1-3-5-8/h1-5,9,14-15H,6-7H2/t9-/m0/s1 |
| InChIKey | TVFZIABLNGLJIN-VIFPVBQESA-N |
| XLogP | 2.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|