About (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane
(1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane (PubChem CID 131850502) has the molecular formula C3H4ClF3O
and a molecular weight of 148.51 g/mol. Its IUPAC name is (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane.
Molecular Properties
| Compound Name | (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane |
| PubChem CID | 131850502 |
| Molecular Formula | C3H4ClF3O |
| Molecular Weight | 148.51 g/mol |
| Exact Mass | 147.99 |
| IUPAC Name | (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane |
| SMILES | FCO[C@H](F)[C@H](F)Cl |
| InChI | InChI=1S/C3H4ClF3O/c4-2(6)3(7)8-1-5/h2-3H,1H2/t2-,3-/m0/s1 |
| InChIKey | CKNCTSJTPOBVIX-HRFVKAFMSA-N |
| XLogP | 1.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane?
The IUPAC name of (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane (CID 131850502) is (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane.
What is the SMILES notation for (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane?
The canonical SMILES for (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane is FCO[C@H](F)[C@H](F)Cl.
What is the InChIKey of (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane?
The InChIKey is CKNCTSJTPOBVIX-HRFVKAFMSA-N. The full InChI is InChI=1S/C3H4ClF3O/c4-2(6)3(7)8-1-5/h2-3H,1H2/t2-,3-/m0/s1.
What are the key properties of (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane?
(1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane has a molecular weight of 148.51 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-1-chloro-1,2-difluoro-2-(fluoromethoxy)ethane is sourced from PubChem (CID 131850502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).