C16H11ClFNO — CID 131850822
6-chloro-2-(4-fluorophenyl)-3-methyl-1H-quinolin-4-one (PubChem CID 131850822) has the molecular formula C16H11ClFNO and a molecular weight of 287.72 g/mol. Its IUPAC name is 6-chloro-2-(4-fluorophenyl)-3-methyl-1H-quinolin-4-one.
| Compound Name | 6-chloro-2-(4-fluorophenyl)-3-methyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 131850822 |
| Molecular Formula | C16H11ClFNO |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 6-chloro-2-(4-fluorophenyl)-3-methyl-1H-quinolin-4-one |
| SMILES | Cc1c(-c2ccc(F)cc2)[nH]c2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C16H11ClFNO/c1-9-15(10-2-5-12(18)6-3-10)19-14-7-4-11(17)8-13(14)16(9)20/h2-8H,1H3,(H,19,20) |
| InChIKey | PGOJBVSOLZKNMP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |