C9H19ClO3 — CID 131850899
(5R,6S)-6-chloro-5-(methoxymethyl)heptane-1,5-diol (PubChem CID 131850899) has the molecular formula C9H19ClO3 and a molecular weight of 210.70 g/mol. Its IUPAC name is (5R,6S)-6-chloro-5-(methoxymethyl)heptane-1,5-diol.
| Compound Name | (5R,6S)-6-chloro-5-(methoxymethyl)heptane-1,5-diol |
|---|---|
| PubChem CID | 131850899 |
| Molecular Formula | C9H19ClO3 |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (5R,6S)-6-chloro-5-(methoxymethyl)heptane-1,5-diol |
| SMILES | COC[C@](O)(CCCCO)[C@H](C)Cl |
| InChI | InChI=1S/C9H19ClO3/c1-8(10)9(12,7-13-2)5-3-4-6-11/h8,11-12H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | CCTAKEYVRIJETN-DTWKUNHWSA-N |
| XLogP | 1.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|