About 3-chloro-1,3-diethoxyprop-1-ene
3-chloro-1,3-diethoxyprop-1-ene (PubChem CID 131851158) has the molecular formula C7H13ClO2
and a molecular weight of 164.63 g/mol. Its IUPAC name is 3-chloro-1,3-diethoxyprop-1-ene.
Molecular Properties
| Compound Name | 3-chloro-1,3-diethoxyprop-1-ene |
| PubChem CID | 131851158 |
| Molecular Formula | C7H13ClO2 |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 3-chloro-1,3-diethoxyprop-1-ene |
| SMILES | CCOC=CC(Cl)OCC |
| InChI | InChI=1S/C7H13ClO2/c1-3-9-6-5-7(8)10-4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | ZYIZBWZHOQCZLT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1,3-diethoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1,3-diethoxyprop-1-ene?
The IUPAC name of 3-chloro-1,3-diethoxyprop-1-ene (CID 131851158) is 3-chloro-1,3-diethoxyprop-1-ene.
What is the SMILES notation for 3-chloro-1,3-diethoxyprop-1-ene?
The canonical SMILES for 3-chloro-1,3-diethoxyprop-1-ene is CCOC=CC(Cl)OCC.
What is the InChIKey of 3-chloro-1,3-diethoxyprop-1-ene?
The InChIKey is ZYIZBWZHOQCZLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClO2/c1-3-9-6-5-7(8)10-4-2/h5-7H,3-4H2,1-2H3.
What are the key properties of 3-chloro-1,3-diethoxyprop-1-ene?
3-chloro-1,3-diethoxyprop-1-ene has a molecular weight of 164.63 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1,3-diethoxyprop-1-ene is sourced from PubChem (CID 131851158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).