C12H11F8NO — CID 131851352
2-(1-ethoxy-1,2,2,3,3,4,4,4-octafluorobutyl)aniline (PubChem CID 131851352) has the molecular formula C12H11F8NO and a molecular weight of 337.21 g/mol. Its IUPAC name is 2-(1-ethoxy-1,2,2,3,3,4,4,4-octafluorobutyl)aniline.
| Compound Name | 2-(1-ethoxy-1,2,2,3,3,4,4,4-octafluorobutyl)aniline |
|---|---|
| PubChem CID | 131851352 |
| Molecular Formula | C12H11F8NO |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(1-ethoxy-1,2,2,3,3,4,4,4-octafluorobutyl)aniline |
| SMILES | CCOC(F)(c1ccccc1N)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F8NO/c1-2-22-9(13,7-5-3-4-6-8(7)21)10(14,15)11(16,17)12(18,19)20/h3-6H,2,21H2,1H3 |
| InChIKey | NIOKERYKVFUYRO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|