C10H13NO4 — CID 131851516
4-hydroxy-5-(2-hydroxyethylamino)-3,6-dimethylcyclohexa-3,5-diene-1,2-dione (PubChem CID 131851516) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-hydroxy-5-(2-hydroxyethylamino)-3,6-dimethylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-hydroxy-5-(2-hydroxyethylamino)-3,6-dimethylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 131851516 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-hydroxy-5-(2-hydroxyethylamino)-3,6-dimethylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CC1=C(O)C(NCCO)=C(C)C(=O)C1=O |
| InChI | InChI=1S/C10H13NO4/c1-5-7(11-3-4-12)8(13)6(2)10(15)9(5)14/h11-13H,3-4H2,1-2H3 |
| InChIKey | ICJFUTZDZJCPLO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|