C12H24O2 — CID 131851897
2,3-dimethyl-1,4-dipropoxybut-2-ene (PubChem CID 131851897) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dipropoxybut-2-ene.
| Compound Name | 2,3-dimethyl-1,4-dipropoxybut-2-ene |
|---|---|
| PubChem CID | 131851897 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 2,3-dimethyl-1,4-dipropoxybut-2-ene |
| SMILES | CCCOCC(C)=C(C)COCCC |
| InChI | InChI=1S/C12H24O2/c1-5-7-13-9-11(3)12(4)10-14-8-6-2/h5-10H2,1-4H3 |
| InChIKey | GBMOZNXHMVLWDG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|