C7H4N4 — CID 131853054
1,5,8,11-tetrazatricyclo[5.2.2.02,6]undeca-2,4,6,8,10-pentaene (PubChem CID 131853054) has the molecular formula C7H4N4 and a molecular weight of 144.14 g/mol. Its IUPAC name is 1,5,8,11-tetrazatricyclo[5.2.2.02,6]undeca-2,4,6,8,10-pentaene.
| Compound Name | 1,5,8,11-tetrazatricyclo[5.2.2.02,6]undeca-2,4,6,8,10-pentaene |
|---|---|
| PubChem CID | 131853054 |
| Molecular Formula | C7H4N4 |
| Molecular Weight | 144.14 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 1,5,8,11-tetrazatricyclo[5.2.2.02,6]undeca-2,4,6,8,10-pentaene |
| SMILES | c1cc2n3cnc(nc3)c-2n1 |
| InChI | InChI=1S/C7H4N4/c1-2-8-6-5(1)11-3-9-7(6)10-4-11/h1-4H |
| InChIKey | GQUMVIKEZFJTPS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |