C8H12F3NO3 — CID 131853056
methyl (3R)-3-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 131853056) has the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. Its IUPAC name is methyl (3R)-3-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | methyl (3R)-3-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 131853056 |
| Molecular Formula | C8H12F3NO3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | methyl (3R)-3-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | CC[C@H](CC(=O)OC)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3/c1-3-5(4-6(13)15-2)12-7(14)8(9,10)11/h5H,3-4H2,1-2H3,(H,12,14)/t5-/m1/s1 |
| InChIKey | JJCPBYDUBRJLSS-RXMQYKEDSA-N |
| XLogP | 1.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |