C8H7F7O2 — CID 131853136
ethyl (E)-4,4,5,5,6,6,6-heptafluorohex-2-enoate (PubChem CID 131853136) has the molecular formula C8H7F7O2 and a molecular weight of 268.13 g/mol. Its IUPAC name is ethyl (E)-4,4,5,5,6,6,6-heptafluorohex-2-enoate.
| Compound Name | ethyl (E)-4,4,5,5,6,6,6-heptafluorohex-2-enoate |
|---|---|
| PubChem CID | 131853136 |
| Molecular Formula | C8H7F7O2 |
| Molecular Weight | 268.13 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | ethyl (E)-4,4,5,5,6,6,6-heptafluorohex-2-enoate |
| SMILES | CCOC(=O)/C=C/C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F7O2/c1-2-17-5(16)3-4-6(9,10)7(11,12)8(13,14)15/h3-4H,2H2,1H3/b4-3+ |
| InChIKey | WSGUVPFPADUHPU-ONEGZZNKSA-N |
| XLogP | 2.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|