About N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide
N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide (PubChem CID 131854352) has the molecular formula C5H10N4OS
and a molecular weight of 174.23 g/mol. Its IUPAC name is N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide.
Molecular Properties
| Compound Name | N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide |
| PubChem CID | 131854352 |
| Molecular Formula | C5H10N4OS |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide |
| SMILES | CCC(=O)N/C(N)=N/C(N)=S |
| InChI | InChI=1S/C5H10N4OS/c1-2-3(10)8-4(6)9-5(7)11/h2H2,1H3,(H5,6,7,8,9,10,11) |
| InChIKey | SQPDDAVLBDOPBI-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide?
The IUPAC name of N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide (CID 131854352) is N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide.
What is the SMILES notation for N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide?
The canonical SMILES for N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide is CCC(=O)N/C(N)=N/C(N)=S.
What is the InChIKey of N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide?
The InChIKey is SQPDDAVLBDOPBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4OS/c1-2-3(10)8-4(6)9-5(7)11/h2H2,1H3,(H5,6,7,8,9,10,11).
What are the key properties of N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide?
N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide has a molecular weight of 174.23 g/mol, XLogP of -0.93, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-N'-carbamothioylcarbamimidoyl]propanamide is sourced from PubChem (CID 131854352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).