About (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide
(4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide (PubChem CID 131854399) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide.
Molecular Properties
| Compound Name | (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide |
| PubChem CID | 131854399 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide |
| SMILES | C=C[C@@H](O)CC(C)C(=O)N(C)C |
| InChI | InChI=1S/C9H17NO2/c1-5-8(11)6-7(2)9(12)10(3)4/h5,7-8,11H,1,6H2,2-4H3/t7?,8-/m1/s1 |
| InChIKey | LMPMYEBOSLDTHM-BRFYHDHCSA-N |
| XLogP | 0.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide?
The IUPAC name of (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide (CID 131854399) is (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide.
What is the SMILES notation for (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide?
The canonical SMILES for (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide is C=C[C@@H](O)CC(C)C(=O)N(C)C.
What is the InChIKey of (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide?
The InChIKey is LMPMYEBOSLDTHM-BRFYHDHCSA-N. The full InChI is InChI=1S/C9H17NO2/c1-5-8(11)6-7(2)9(12)10(3)4/h5,7-8,11H,1,6H2,2-4H3/t7?,8-/m1/s1.
What are the key properties of (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide?
(4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide has a molecular weight of 171.24 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-hydroxy-N,N,2-trimethylhex-5-enamide is sourced from PubChem (CID 131854399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).