About (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran
(2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran (PubChem CID 131854714) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran.
Molecular Properties
| Compound Name | (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran |
| PubChem CID | 131854714 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran |
| SMILES | CO[C@@H]1C=CC[C@H](C)O1 |
| InChI | InChI=1S/C7H12O2/c1-6-4-3-5-7(8-2)9-6/h3,5-7H,4H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | BLKWOVRREZIAMR-BQBZGAKWSA-N |
| XLogP | 1.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran?
The IUPAC name of (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran (CID 131854714) is (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran.
What is the SMILES notation for (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran?
The canonical SMILES for (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran is CO[C@@H]1C=CC[C@H](C)O1.
What is the InChIKey of (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran?
The InChIKey is BLKWOVRREZIAMR-BQBZGAKWSA-N. The full InChI is InChI=1S/C7H12O2/c1-6-4-3-5-7(8-2)9-6/h3,5-7H,4H2,1-2H3/t6-,7-/m0/s1.
What are the key properties of (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran?
(2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran has a molecular weight of 128.17 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran is sourced from PubChem (CID 131854714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).