About CID 131854846
CID 131854846 (PubChem CID 131854846) has the molecular formula C8H8NaO4
and a molecular weight of 191.14 g/mol.
Molecular Properties
| Compound Name | CID 131854846 |
| PubChem CID | 131854846 |
| Molecular Formula | C8H8NaO4 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | — |
| SMILES | O=C(O)COc1ccccc1O.[Na] |
| InChI | InChI=1S/C8H8O4.Na/c9-6-3-1-2-4-7(6)12-5-8(10)11;/h1-4,9H,5H2,(H,10,11); |
| InChIKey | FHEBCEUWXGADKP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 131854846 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131854846?
The IUPAC name of CID 131854846 (CID 131854846) is not available.
What is the SMILES notation for CID 131854846?
The canonical SMILES for CID 131854846 is O=C(O)COc1ccccc1O.[Na].
What is the InChIKey of CID 131854846?
The InChIKey is FHEBCEUWXGADKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4.Na/c9-6-3-1-2-4-7(6)12-5-8(10)11;/h1-4,9H,5H2,(H,10,11);.
What are the key properties of CID 131854846?
CID 131854846 has a molecular weight of 191.14 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131854846 is sourced from PubChem (CID 131854846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).