C25H26N2NaO7S2 — CID 131855567
2-(3,6-Bis(ethylamino)-2,7-dimethylxanthylium-9-yl)-5-sulfobenzenesulfonate, sodium salt (PubChem CID 131855567) has the molecular formula C25H26N2NaO7S2 and a molecular weight of 553.61 g/mol.
| Compound Name | 2-(3,6-Bis(ethylamino)-2,7-dimethylxanthylium-9-yl)-5-sulfobenzenesulfonate, sodium salt |
|---|---|
| PubChem CID | 131855567 |
| Molecular Formula | C25H26N2NaO7S2 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | — |
| SMILES | CCNc1cc2oc3c/c(=[NH+]\CC)c(C)cc-3c(-c3ccc(S(=O)(=O)O)cc3S(=O)(=O)[O-])c2cc1C.[Na] |
| InChI | InChI=1S/C25H26N2O7S2.Na/c1-5-26-20-12-22-18(9-14(20)3)25(19-10-15(4)21(27-6-2)13-23(19)34-22)17-8-7-16(35(28,29)30)11-24(17)36(31,32)33;/h7-13,26H,5-6H2,1-4H3,(H,28,29,30)(H,31,32,33);/b27-21+; |
| InChIKey | STIJTUXGFIBCBV-XTNAOULASA-N |
| XLogP | 2.02 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|