C11H13NO4 — CID 131856954
(3aR,4S,7aR)-2-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-4-carboxylic acid (PubChem CID 131856954) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is (3aR,4S,7aR)-2-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-4-carboxylic acid.
| Compound Name | (3aR,4S,7aR)-2-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 131856954 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (3aR,4S,7aR)-2-ethyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindole-4-carboxylic acid |
| SMILES | CCN1C(=O)[C@H]2[C@@H](C(=O)O)C=CC[C@H]2C1=O |
| InChI | InChI=1S/C11H13NO4/c1-2-12-9(13)6-4-3-5-7(11(15)16)8(6)10(12)14/h3,5-8H,2,4H2,1H3,(H,15,16)/t6-,7+,8-/m1/s1 |
| InChIKey | KLVRMQILKMHZDQ-GJMOJQLCSA-N |
| XLogP | 0.27 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|