About (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole
(3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole (PubChem CID 131857314) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole.
Molecular Properties
| Compound Name | (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole |
| PubChem CID | 131857314 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole |
| SMILES | C/C=C1/[C@H](C)N=N[C@@H]1C |
| InChI | InChI=1S/C7H12N2/c1-4-7-5(2)8-9-6(7)3/h4-6H,1-3H3/b7-4-/t5-,6+/m0/s1 |
| InChIKey | AIKRGQNVLJJJMH-CFDJTYOJSA-N |
| XLogP | 2.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole?
The IUPAC name of (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole (CID 131857314) is (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole.
What is the SMILES notation for (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole?
The canonical SMILES for (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole is C/C=C1/[C@H](C)N=N[C@@H]1C.
What is the InChIKey of (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole?
The InChIKey is AIKRGQNVLJJJMH-CFDJTYOJSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-7-5(2)8-9-6(7)3/h4-6H,1-3H3/b7-4-/t5-,6+/m0/s1.
What are the key properties of (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole?
(3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole has a molecular weight of 124.19 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-4-ethylidene-3,5-dimethyl-3,5-dihydropyrazole is sourced from PubChem (CID 131857314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).