About 2-Aziridinecarboxylic acid, monolithium salt, (2S)-
2-Aziridinecarboxylic acid, monolithium salt, (2S)- (PubChem CID 131857328) has the molecular formula C3H5LiNO2
and a molecular weight of 94.02 g/mol.
Molecular Properties
| Compound Name | 2-Aziridinecarboxylic acid, monolithium salt, (2S)- |
| PubChem CID | 131857328 |
| Molecular Formula | C3H5LiNO2 |
| Molecular Weight | 94.02 g/mol |
| Exact Mass | 94.05 |
| IUPAC Name | — |
| SMILES | O=C(O)[C@@H]1CN1.[Li] |
| InChI | InChI=1S/C3H5NO2.Li/c5-3(6)2-1-4-2;/h2,4H,1H2,(H,5,6);/t2-;/m0./s1 |
| InChIKey | UUYBCTNKESNGIN-DKWTVANSSA-N |
| XLogP | -1.34 |
| TPSA | 59.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.02 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-Aziridinecarboxylic acid, monolithium salt, (2S)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Aziridinecarboxylic acid, monolithium salt, (2S)-?
The IUPAC name of 2-Aziridinecarboxylic acid, monolithium salt, (2S)- (CID 131857328) is not available.
What is the SMILES notation for 2-Aziridinecarboxylic acid, monolithium salt, (2S)-?
The canonical SMILES for 2-Aziridinecarboxylic acid, monolithium salt, (2S)- is O=C(O)[C@@H]1CN1.[Li].
What is the InChIKey of 2-Aziridinecarboxylic acid, monolithium salt, (2S)-?
The InChIKey is UUYBCTNKESNGIN-DKWTVANSSA-N. The full InChI is InChI=1S/C3H5NO2.Li/c5-3(6)2-1-4-2;/h2,4H,1H2,(H,5,6);/t2-;/m0./s1.
What are the key properties of 2-Aziridinecarboxylic acid, monolithium salt, (2S)-?
2-Aziridinecarboxylic acid, monolithium salt, (2S)- has a molecular weight of 94.02 g/mol, XLogP of -1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Aziridinecarboxylic acid, monolithium salt, (2S)- is sourced from PubChem (CID 131857328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).