About cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride
cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride (PubChem CID 131857466) has the molecular formula C9H11ClO3
and a molecular weight of 202.64 g/mol. Its IUPAC name is cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride.
Molecular Properties
| Compound Name | cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride |
| PubChem CID | 131857466 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride |
| SMILES | O=C1CCC[C@H]([C@H]2C[C@@H]2C(=O)Cl)O1 |
| InChI | InChI=1S/C9H11ClO3/c10-9(12)6-4-5(6)7-2-1-3-8(11)13-7/h5-7H,1-4H2/t5-,6-,7+/m0/s1 |
| InChIKey | HUXNLWKXLWTSEM-LYFYHCNISA-N |
| XLogP | 1.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride?
The IUPAC name of cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride (CID 131857466) is cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride.
What is the SMILES notation for cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride?
The canonical SMILES for cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride is O=C1CCC[C@H]([C@H]2C[C@@H]2C(=O)Cl)O1.
What is the InChIKey of cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride?
The InChIKey is HUXNLWKXLWTSEM-LYFYHCNISA-N. The full InChI is InChI=1S/C9H11ClO3/c10-9(12)6-4-5(6)7-2-1-3-8(11)13-7/h5-7H,1-4H2/t5-,6-,7+/m0/s1.
What are the key properties of cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride?
cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride has a molecular weight of 202.64 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-2-[(2R)-6-oxooxan-2-yl]cyclopropane-1-carbonyl chloride is sourced from PubChem (CID 131857466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).