C11H16N2 — CID 131857748
(3S,5R)-3-ethenyl-5-[(1E,3E)-hexa-1,3-dienyl]-4,5-dihydro-3H-pyrazole (PubChem CID 131857748) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (3S,5R)-3-ethenyl-5-[(1E,3E)-hexa-1,3-dienyl]-4,5-dihydro-3H-pyrazole.
| Compound Name | (3S,5R)-3-ethenyl-5-[(1E,3E)-hexa-1,3-dienyl]-4,5-dihydro-3H-pyrazole |
|---|---|
| PubChem CID | 131857748 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (3S,5R)-3-ethenyl-5-[(1E,3E)-hexa-1,3-dienyl]-4,5-dihydro-3H-pyrazole |
| SMILES | C=C[C@@H]1C[C@H](/C=C/C=C/CC)N=N1 |
| InChI | InChI=1S/C11H16N2/c1-3-5-6-7-8-11-9-10(4-2)12-13-11/h4-8,10-11H,2-3,9H2,1H3/b6-5+,8-7+/t10-,11+/m1/s1 |
| InChIKey | CZRMGUVGSWPZAP-JVOFEHHBSA-N |
| XLogP | 3.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|