C12H20O2 — CID 131857790
(1S,5S,6R,8R)-6-methyltricyclo[6.3.0.01,5]undecane-5,8-diol (PubChem CID 131857790) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1S,5S,6R,8R)-6-methyltricyclo[6.3.0.01,5]undecane-5,8-diol.
| Compound Name | (1S,5S,6R,8R)-6-methyltricyclo[6.3.0.01,5]undecane-5,8-diol |
|---|---|
| PubChem CID | 131857790 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1S,5S,6R,8R)-6-methyltricyclo[6.3.0.01,5]undecane-5,8-diol |
| SMILES | C[C@@H]1C[C@]2(O)CCC[C@]23CCC[C@]13O |
| InChI | InChI=1S/C12H20O2/c1-9-8-11(13)6-2-4-10(11)5-3-7-12(9,10)14/h9,13-14H,2-8H2,1H3/t9-,10+,11-,12+/m1/s1 |
| InChIKey | PCYBHMGGXJHGDE-KXNHARMFSA-N |
| XLogP | 1.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |