C11H10N4 — CID 13185783
3,6-dimethyl-[1,2,4]triazolo[3,4-a]phthalazine (PubChem CID 13185783) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 3,6-dimethyl-[1,2,4]triazolo[3,4-a]phthalazine.
| Compound Name | 3,6-dimethyl-[1,2,4]triazolo[3,4-a]phthalazine |
|---|---|
| PubChem CID | 13185783 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 3,6-dimethyl-[1,2,4]triazolo[3,4-a]phthalazine |
| SMILES | Cc1nn2c(C)nnc2c2ccccc12 |
| InChI | InChI=1S/C11H10N4/c1-7-9-5-3-4-6-10(9)11-13-12-8(2)15(11)14-7/h3-6H,1-2H3 |
| InChIKey | YLIQBTQJJIWRSF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |