C9H11ClN2S — CID 131857879
4-methyl-1,4-benzothiazin-3-imine;hydrochloride (PubChem CID 131857879) has the molecular formula C9H11ClN2S and a molecular weight of 214.72 g/mol. Its IUPAC name is 4-methyl-1,4-benzothiazin-3-imine;hydrochloride.
| Compound Name | 4-methyl-1,4-benzothiazin-3-imine;hydrochloride |
|---|---|
| PubChem CID | 131857879 |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 4-methyl-1,4-benzothiazin-3-imine;hydrochloride |
| SMILES | Cl.[H]/N=C1\CSc2ccccc2N1C |
| InChI | InChI=1S/C9H10N2S.ClH/c1-11-7-4-2-3-5-8(7)12-6-9(11)10;/h2-5,10H,6H2,1H3;1H/b10-9+; |
| InChIKey | GFAUGHRIHYEPQF-RRABGKBLSA-N |
| XLogP | 2.63 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|