About 4-methyl-1,4-benzothiazin-3-imine;hydrochloride
4-methyl-1,4-benzothiazin-3-imine;hydrochloride (PubChem CID 131857879) has the molecular formula C9H11ClN2S
and a molecular weight of 214.72 g/mol. Its IUPAC name is 4-methyl-1,4-benzothiazin-3-imine;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-1,4-benzothiazin-3-imine;hydrochloride |
| PubChem CID | 131857879 |
| Molecular Formula | C9H11ClN2S |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 4-methyl-1,4-benzothiazin-3-imine;hydrochloride |
| SMILES | Cl.[H]/N=C1\CSc2ccccc2N1C |
| InChI | InChI=1S/C9H10N2S.ClH/c1-11-7-4-2-3-5-8(7)12-6-9(11)10;/h2-5,10H,6H2,1H3;1H/b10-9+; |
| InChIKey | GFAUGHRIHYEPQF-RRABGKBLSA-N |
| XLogP | 2.63 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,4-benzothiazin-3-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,4-benzothiazin-3-imine;hydrochloride?
The IUPAC name of 4-methyl-1,4-benzothiazin-3-imine;hydrochloride (CID 131857879) is 4-methyl-1,4-benzothiazin-3-imine;hydrochloride.
What is the SMILES notation for 4-methyl-1,4-benzothiazin-3-imine;hydrochloride?
The canonical SMILES for 4-methyl-1,4-benzothiazin-3-imine;hydrochloride is Cl.[H]/N=C1\CSc2ccccc2N1C.
What is the InChIKey of 4-methyl-1,4-benzothiazin-3-imine;hydrochloride?
The InChIKey is GFAUGHRIHYEPQF-RRABGKBLSA-N. The full InChI is InChI=1S/C9H10N2S.ClH/c1-11-7-4-2-3-5-8(7)12-6-9(11)10;/h2-5,10H,6H2,1H3;1H/b10-9+;.
What are the key properties of 4-methyl-1,4-benzothiazin-3-imine;hydrochloride?
4-methyl-1,4-benzothiazin-3-imine;hydrochloride has a molecular weight of 214.72 g/mol, XLogP of 2.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,4-benzothiazin-3-imine;hydrochloride is sourced from PubChem (CID 131857879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).