About CID 131858183
CID 131858183 (PubChem CID 131858183) has the molecular formula C10H10N2PbS2
and a molecular weight of 429.54 g/mol.
Molecular Properties
| Compound Name | CID 131858183 |
| PubChem CID | 131858183 |
| Molecular Formula | C10H10N2PbS2 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | — |
| SMILES | S=c1cccc[nH]1.S=c1cccc[nH]1.[Pb] |
| InChI | InChI=1S/2C5H5NS.Pb/c2*7-5-3-1-2-4-6-5;/h2*1-4H,(H,6,7); |
| InChIKey | KCUIITYRFRLOMV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 131858183 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131858183?
The IUPAC name of CID 131858183 (CID 131858183) is not available.
What is the SMILES notation for CID 131858183?
The canonical SMILES for CID 131858183 is S=c1cccc[nH]1.S=c1cccc[nH]1.[Pb].
What is the InChIKey of CID 131858183?
The InChIKey is KCUIITYRFRLOMV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5NS.Pb/c2*7-5-3-1-2-4-6-5;/h2*1-4H,(H,6,7);.
What are the key properties of CID 131858183?
CID 131858183 has a molecular weight of 429.54 g/mol, XLogP of 3.11, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131858183 is sourced from PubChem (CID 131858183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).