About (3S)-3-amino-1-methylazetidin-2-one;hydron
(3S)-3-amino-1-methylazetidin-2-one;hydron (PubChem CID 131858386) has the molecular formula C4H9N2O+
and a molecular weight of 101.13 g/mol. Its IUPAC name is (3S)-3-amino-1-methylazetidin-2-one;hydron.
Molecular Properties
| Compound Name | (3S)-3-amino-1-methylazetidin-2-one;hydron |
| PubChem CID | 131858386 |
| Molecular Formula | C4H9N2O+ |
| Molecular Weight | 101.13 g/mol |
| Exact Mass | 101.07 |
| IUPAC Name | (3S)-3-amino-1-methylazetidin-2-one;hydron |
| SMILES | CN1C[C@H](N)C1=O.[H+] |
| InChI | InChI=1S/C4H8N2O/c1-6-2-3(5)4(6)7/h3H,2,5H2,1H3/p+1/t3-/m0/s1 |
| InChIKey | XOBUVRCCYJYVJL-VKHMYHEASA-O |
| XLogP | -1.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.13 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-amino-1-methylazetidin-2-one;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-1-methylazetidin-2-one;hydron?
The IUPAC name of (3S)-3-amino-1-methylazetidin-2-one;hydron (CID 131858386) is (3S)-3-amino-1-methylazetidin-2-one;hydron.
What is the SMILES notation for (3S)-3-amino-1-methylazetidin-2-one;hydron?
The canonical SMILES for (3S)-3-amino-1-methylazetidin-2-one;hydron is CN1C[C@H](N)C1=O.[H+].
What is the InChIKey of (3S)-3-amino-1-methylazetidin-2-one;hydron?
The InChIKey is XOBUVRCCYJYVJL-VKHMYHEASA-O. The full InChI is InChI=1S/C4H8N2O/c1-6-2-3(5)4(6)7/h3H,2,5H2,1H3/p+1/t3-/m0/s1.
What are the key properties of (3S)-3-amino-1-methylazetidin-2-one;hydron?
(3S)-3-amino-1-methylazetidin-2-one;hydron has a molecular weight of 101.13 g/mol, XLogP of -1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-1-methylazetidin-2-one;hydron is sourced from PubChem (CID 131858386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).