About 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane
5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane (PubChem CID 131858390) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane.
Molecular Properties
| Compound Name | 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane |
| PubChem CID | 131858390 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane |
| SMILES | C=C1C(=C)C2CCC1OO2 |
| InChI | InChI=1S/C8H10O2/c1-5-6(2)8-4-3-7(5)9-10-8/h7-8H,1-4H2 |
| InChIKey | MTYLMWFCSQAHIO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane?
The IUPAC name of 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane (CID 131858390) is 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane.
What is the SMILES notation for 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane?
The canonical SMILES for 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane is C=C1C(=C)C2CCC1OO2.
What is the InChIKey of 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane?
The InChIKey is MTYLMWFCSQAHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-5-6(2)8-4-3-7(5)9-10-8/h7-8H,1-4H2.
What are the key properties of 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane?
5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane has a molecular weight of 138.17 g/mol, XLogP of 1.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethylidene-2,3-dioxabicyclo[2.2.2]octane is sourced from PubChem (CID 131858390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).