About ethyl 2-nitramidopropanoate
ethyl 2-nitramidopropanoate (PubChem CID 131858521) has the molecular formula C5H10N2O4
and a molecular weight of 162.14 g/mol. Its IUPAC name is ethyl 2-nitramidopropanoate.
Molecular Properties
| Compound Name | ethyl 2-nitramidopropanoate |
| PubChem CID | 131858521 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | ethyl 2-nitramidopropanoate |
| SMILES | CCOC(=O)C(C)N[N+](=O)[O-] |
| InChI | InChI=1S/C5H10N2O4/c1-3-11-5(8)4(2)6-7(9)10/h4,6H,3H2,1-2H3 |
| InChIKey | OCRDUTQLMFTLFG-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-nitramidopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-nitramidopropanoate?
The IUPAC name of ethyl 2-nitramidopropanoate (CID 131858521) is ethyl 2-nitramidopropanoate.
What is the SMILES notation for ethyl 2-nitramidopropanoate?
The canonical SMILES for ethyl 2-nitramidopropanoate is CCOC(=O)C(C)N[N+](=O)[O-].
What is the InChIKey of ethyl 2-nitramidopropanoate?
The InChIKey is OCRDUTQLMFTLFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O4/c1-3-11-5(8)4(2)6-7(9)10/h4,6H,3H2,1-2H3.
What are the key properties of ethyl 2-nitramidopropanoate?
ethyl 2-nitramidopropanoate has a molecular weight of 162.14 g/mol, XLogP of -0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-nitramidopropanoate is sourced from PubChem (CID 131858521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).