About 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane
3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane (PubChem CID 131858780) has the molecular formula C8H14S4
and a molecular weight of 238.47 g/mol. Its IUPAC name is 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane.
Molecular Properties
| Compound Name | 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane |
| PubChem CID | 131858780 |
| Molecular Formula | C8H14S4 |
| Molecular Weight | 238.47 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane |
| SMILES | CC(C)=C1SSC(C(C)C)SS1 |
| InChI | InChI=1S/C8H14S4/c1-5(2)7-9-11-8(6(3)4)12-10-7/h5,7H,1-4H3 |
| InChIKey | LMYJIVTYLOPCFC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane?
The IUPAC name of 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane (CID 131858780) is 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane.
What is the SMILES notation for 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane?
The canonical SMILES for 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane is CC(C)=C1SSC(C(C)C)SS1.
What is the InChIKey of 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane?
The InChIKey is LMYJIVTYLOPCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14S4/c1-5(2)7-9-11-8(6(3)4)12-10-7/h5,7H,1-4H3.
What are the key properties of 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane?
3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane has a molecular weight of 238.47 g/mol, XLogP of 5.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-6-propan-2-ylidene-1,2,4,5-tetrathiane is sourced from PubChem (CID 131858780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).