C9H12Cl4O4 — CID 131859137
1,2,4,4-tetrachloro-3,3,5,5-tetramethoxycyclopentene (PubChem CID 131859137) has the molecular formula C9H12Cl4O4 and a molecular weight of 326.00 g/mol. Its IUPAC name is 1,2,4,4-tetrachloro-3,3,5,5-tetramethoxycyclopentene.
| Compound Name | 1,2,4,4-tetrachloro-3,3,5,5-tetramethoxycyclopentene |
|---|---|
| PubChem CID | 131859137 |
| Molecular Formula | C9H12Cl4O4 |
| Molecular Weight | 326.00 g/mol |
| Exact Mass | 323.95 |
| IUPAC Name | 1,2,4,4-tetrachloro-3,3,5,5-tetramethoxycyclopentene |
| SMILES | COC1(OC)C(Cl)=C(Cl)C(OC)(OC)C1(Cl)Cl |
| InChI | InChI=1S/C9H12Cl4O4/c1-14-7(15-2)5(10)6(11)8(16-3,17-4)9(7,12)13/h1-4H3 |
| InChIKey | ZQVXLXXIYCCEHI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.00 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|