C15H19NO — CID 131859515
(4aR,10bR)-2,10-dimethyl-1,3,4,4a,5,10b-hexahydrobenzo[h]isoquinolin-6-one (PubChem CID 131859515) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (4aR,10bR)-2,10-dimethyl-1,3,4,4a,5,10b-hexahydrobenzo[h]isoquinolin-6-one.
| Compound Name | (4aR,10bR)-2,10-dimethyl-1,3,4,4a,5,10b-hexahydrobenzo[h]isoquinolin-6-one |
|---|---|
| PubChem CID | 131859515 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (4aR,10bR)-2,10-dimethyl-1,3,4,4a,5,10b-hexahydrobenzo[h]isoquinolin-6-one |
| SMILES | Cc1cccc2c1[C@@H]1CN(C)CC[C@@H]1CC2=O |
| InChI | InChI=1S/C15H19NO/c1-10-4-3-5-12-14(17)8-11-6-7-16(2)9-13(11)15(10)12/h3-5,11,13H,6-9H2,1-2H3/t11-,13-/m1/s1 |
| InChIKey | RKEAVIMSJQDUOF-DGCLKSJQSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |