C15H15ClO — CID 131860634
1-chloro-3-[2-(4-methoxyphenyl)ethyl]benzene (PubChem CID 131860634) has the molecular formula C15H15ClO and a molecular weight of 246.74 g/mol. Its IUPAC name is 1-chloro-3-[2-(4-methoxyphenyl)ethyl]benzene.
| Compound Name | 1-chloro-3-[2-(4-methoxyphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 131860634 |
| Molecular Formula | C15H15ClO |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-chloro-3-[2-(4-methoxyphenyl)ethyl]benzene |
| SMILES | COc1ccc(CCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H15ClO/c1-17-15-9-7-12(8-10-15)5-6-13-3-2-4-14(16)11-13/h2-4,7-11H,5-6H2,1H3 |
| InChIKey | SMAYAEMLGFLYEM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |