C14H21N5 — CID 131860842
2,8-dimethyl-9-propyl-6-pyrrolidin-1-ylpurine (PubChem CID 131860842) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2,8-dimethyl-9-propyl-6-pyrrolidin-1-ylpurine.
| Compound Name | 2,8-dimethyl-9-propyl-6-pyrrolidin-1-ylpurine |
|---|---|
| PubChem CID | 131860842 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2,8-dimethyl-9-propyl-6-pyrrolidin-1-ylpurine |
| SMILES | CCCn1c(C)nc2c(N3CCCC3)nc(C)nc21 |
| InChI | InChI=1S/C14H21N5/c1-4-7-19-11(3)17-12-13(18-8-5-6-9-18)15-10(2)16-14(12)19/h4-9H2,1-3H3 |
| InChIKey | WCYJXEBNHSTRRB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |