C8H6BrCl3O — CID 131861146
4-bromo-2,4,6-trichloro-3,5-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 131861146) has the molecular formula C8H6BrCl3O and a molecular weight of 304.40 g/mol. Its IUPAC name is 4-bromo-2,4,6-trichloro-3,5-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-bromo-2,4,6-trichloro-3,5-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 131861146 |
| Molecular Formula | C8H6BrCl3O |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 301.87 |
| IUPAC Name | 4-bromo-2,4,6-trichloro-3,5-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=C(Cl)C(=O)C(Cl)=C(C)C1(Cl)Br |
| InChI | InChI=1S/C8H6BrCl3O/c1-3-5(10)7(13)6(11)4(2)8(3,9)12/h1-2H3 |
| InChIKey | XPUMGQGKBPOFQB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|