C8H11IO5 — CID 131861335
(3aR,6S,6aS)-2-ethoxy-6-(iodomethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (PubChem CID 131861335) has the molecular formula C8H11IO5 and a molecular weight of 314.08 g/mol. Its IUPAC name is (3aR,6S,6aS)-2-ethoxy-6-(iodomethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one.
| Compound Name | (3aR,6S,6aS)-2-ethoxy-6-(iodomethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 131861335 |
| Molecular Formula | C8H11IO5 |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | (3aR,6S,6aS)-2-ethoxy-6-(iodomethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| SMILES | CCOC1O[C@@H]2[C@@H](CI)OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C8H11IO5/c1-2-11-8-13-5-4(3-9)12-7(10)6(5)14-8/h4-6,8H,2-3H2,1H3/t4-,5-,6-,8?/m1/s1 |
| InChIKey | IDLBMCGKRCWHAD-CDRSNLLMSA-N |
| XLogP | 0.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|