C7H13NO2S — CID 131861556
(3S,4R)-3-ethyl-4-(2-hydroxyethylsulfanyl)azetidin-2-one (PubChem CID 131861556) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is (3S,4R)-3-ethyl-4-(2-hydroxyethylsulfanyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-ethyl-4-(2-hydroxyethylsulfanyl)azetidin-2-one |
|---|---|
| PubChem CID | 131861556 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (3S,4R)-3-ethyl-4-(2-hydroxyethylsulfanyl)azetidin-2-one |
| SMILES | CC[C@H]1C(=O)N[C@@H]1SCCO |
| InChI | InChI=1S/C7H13NO2S/c1-2-5-6(10)8-7(5)11-4-3-9/h5,7,9H,2-4H2,1H3,(H,8,10)/t5-,7+/m0/s1 |
| InChIKey | ZUMWEJBXNLPOJY-CAHLUQPWSA-N |
| XLogP | 0.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |