About 3-methylcyclopenta-2,4-diene-1-carbaldehyde
3-methylcyclopenta-2,4-diene-1-carbaldehyde (PubChem CID 131862306) has the molecular formula C7H8O
and a molecular weight of 108.14 g/mol. Its IUPAC name is 3-methylcyclopenta-2,4-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-methylcyclopenta-2,4-diene-1-carbaldehyde |
| PubChem CID | 131862306 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | 3-methylcyclopenta-2,4-diene-1-carbaldehyde |
| SMILES | CC1=CC(C=O)C=C1 |
| InChI | InChI=1S/C7H8O/c1-6-2-3-7(4-6)5-8/h2-5,7H,1H3 |
| InChIKey | NPLIHVFUEGROSQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methylcyclopenta-2,4-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylcyclopenta-2,4-diene-1-carbaldehyde?
The IUPAC name of 3-methylcyclopenta-2,4-diene-1-carbaldehyde (CID 131862306) is 3-methylcyclopenta-2,4-diene-1-carbaldehyde.
What is the SMILES notation for 3-methylcyclopenta-2,4-diene-1-carbaldehyde?
The canonical SMILES for 3-methylcyclopenta-2,4-diene-1-carbaldehyde is CC1=CC(C=O)C=C1.
What is the InChIKey of 3-methylcyclopenta-2,4-diene-1-carbaldehyde?
The InChIKey is NPLIHVFUEGROSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O/c1-6-2-3-7(4-6)5-8/h2-5,7H,1H3.
What are the key properties of 3-methylcyclopenta-2,4-diene-1-carbaldehyde?
3-methylcyclopenta-2,4-diene-1-carbaldehyde has a molecular weight of 108.14 g/mol, XLogP of 1.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylcyclopenta-2,4-diene-1-carbaldehyde is sourced from PubChem (CID 131862306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).