About 5-hydroxydec-7-ynoic acid
5-hydroxydec-7-ynoic acid (PubChem CID 131862407) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 5-hydroxydec-7-ynoic acid.
Molecular Properties
| Compound Name | 5-hydroxydec-7-ynoic acid |
| PubChem CID | 131862407 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 5-hydroxydec-7-ynoic acid |
| SMILES | CCC#CCC(O)CCCC(=O)O |
| InChI | InChI=1S/C10H16O3/c1-2-3-4-6-9(11)7-5-8-10(12)13/h9,11H,2,5-8H2,1H3,(H,12,13) |
| InChIKey | DOTXOHVZFKMFAE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxydec-7-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxydec-7-ynoic acid?
The IUPAC name of 5-hydroxydec-7-ynoic acid (CID 131862407) is 5-hydroxydec-7-ynoic acid.
What is the SMILES notation for 5-hydroxydec-7-ynoic acid?
The canonical SMILES for 5-hydroxydec-7-ynoic acid is CCC#CCC(O)CCCC(=O)O.
What is the InChIKey of 5-hydroxydec-7-ynoic acid?
The InChIKey is DOTXOHVZFKMFAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-2-3-4-6-9(11)7-5-8-10(12)13/h9,11H,2,5-8H2,1H3,(H,12,13).
What are the key properties of 5-hydroxydec-7-ynoic acid?
5-hydroxydec-7-ynoic acid has a molecular weight of 184.23 g/mol, XLogP of 1.41, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxydec-7-ynoic acid is sourced from PubChem (CID 131862407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).