C8H9Br — CID 131862817
1-(1-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene (PubChem CID 131862817) has the molecular formula C8H9Br and a molecular weight of 190.09 g/mol. Its IUPAC name is 1-(1-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene.
| Compound Name | 1-(1-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene |
|---|---|
| PubChem CID | 131862817 |
| Molecular Formula | C8H9Br |
| Molecular Weight | 190.09 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 1-(1-bromoethyl)-2,3,4,5,6-pentadeuteriobenzene |
| SMILES | [2H]c1c([2H])c([2H])c(C(C)Br)c([2H])c1[2H] |
| InChI | InChI=1S/C8H9Br/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3/i2D,3D,4D,5D,6D |
| InChIKey | CRRUGYDDEMGVDY-VIQYUKPQSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.09 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|